C19H22N2O5 — CID 2503619
[2-[4-(dimethylamino)anilino]-2-oxoethyl] 2,3-dimethoxybenzoate (PubChem CID 2503619) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is [2-[4-(dimethylamino)anilino]-2-oxoethyl] 2,3-dimethoxybenzoate.
| Compound Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 2,3-dimethoxybenzoate |
|---|---|
| PubChem CID | 2503619 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 2,3-dimethoxybenzoate |
| SMILES | COc1cccc(C(=O)OCC(=O)Nc2ccc(N(C)C)cc2)c1OC |
| InChI | InChI=1S/C19H22N2O5/c1-21(2)14-10-8-13(9-11-14)20-17(22)12-26-19(23)15-6-5-7-16(24-3)18(15)25-4/h5-11H,12H2,1-4H3,(H,20,22) |
| InChIKey | LAKHSWDOFWLCHP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|