C18H19NO6 — CID 2503626
[2-(4-methoxyanilino)-2-oxoethyl] 2,3-dimethoxybenzoate (PubChem CID 2503626) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is [2-(4-methoxyanilino)-2-oxoethyl] 2,3-dimethoxybenzoate.
| Compound Name | [2-(4-methoxyanilino)-2-oxoethyl] 2,3-dimethoxybenzoate |
|---|---|
| PubChem CID | 2503626 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | [2-(4-methoxyanilino)-2-oxoethyl] 2,3-dimethoxybenzoate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2cccc(OC)c2OC)cc1 |
| InChI | InChI=1S/C18H19NO6/c1-22-13-9-7-12(8-10-13)19-16(20)11-25-18(21)14-5-4-6-15(23-2)17(14)24-3/h4-10H,11H2,1-3H3,(H,19,20) |
| InChIKey | PSQYQOHSLCHRGM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |