C27H27NO4 — CID 2078940
[2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate (PubChem CID 2078940) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is [2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate.
| Compound Name | [2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate |
|---|---|
| PubChem CID | 2078940 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | [2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate |
| SMILES | CC[C@@H](C)c1ccc(NC(=O)COC(=O)c2ccccc2C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H27NO4/c1-4-19(3)20-13-15-22(16-14-20)28-25(29)17-32-27(31)24-8-6-5-7-23(24)26(30)21-11-9-18(2)10-12-21/h5-16,19H,4,17H2,1-3H3,(H,28,29)/t19-/m1/s1 |
| InChIKey | ZIMBMXNAOZHFMO-LJQANCHMSA-N |
| XLogP | 5.54 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |