C27H34N2O4 — CID 4565386
[2-(4-butan-2-ylanilino)-2-oxoethyl] 2-[cyclohexyl(methyl)carbamoyl]benzoate (PubChem CID 4565386) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is [2-(4-butan-2-ylanilino)-2-oxoethyl] 2-[cyclohexyl(methyl)carbamoyl]benzoate.
| Compound Name | [2-(4-butan-2-ylanilino)-2-oxoethyl] 2-[cyclohexyl(methyl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 4565386 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | [2-(4-butan-2-ylanilino)-2-oxoethyl] 2-[cyclohexyl(methyl)carbamoyl]benzoate |
| SMILES | CCC(C)c1ccc(NC(=O)COC(=O)c2ccccc2C(=O)N(C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C27H34N2O4/c1-4-19(2)20-14-16-21(17-15-20)28-25(30)18-33-27(32)24-13-9-8-12-23(24)26(31)29(3)22-10-6-5-7-11-22/h8-9,12-17,19,22H,4-7,10-11,18H2,1-3H3,(H,28,30) |
| InChIKey | FMEMVDYGYDVGPN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |