C24H26N2O4 — CID 7224219
[2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 2-(furan-2-ylmethylamino)benzoate (PubChem CID 7224219) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is [2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 2-(furan-2-ylmethylamino)benzoate.
| Compound Name | [2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 2-(furan-2-ylmethylamino)benzoate |
|---|---|
| PubChem CID | 7224219 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | [2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 2-(furan-2-ylmethylamino)benzoate |
| SMILES | CC[C@H](C)c1ccc(NC(=O)COC(=O)c2ccccc2NCc2ccco2)cc1 |
| InChI | InChI=1S/C24H26N2O4/c1-3-17(2)18-10-12-19(13-11-18)26-23(27)16-30-24(28)21-8-4-5-9-22(21)25-15-20-7-6-14-29-20/h4-14,17,25H,3,15-16H2,1-2H3,(H,26,27)/t17-/m0/s1 |
| InChIKey | HDHLWOBKQZXUHA-KRWDZBQOSA-N |
| XLogP | 5.20 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |