C22H20N4O6 — CID 4840922
[2-(3,5-dicarbamoylanilino)-2-oxoethyl] 2-(furan-2-ylmethylamino)benzoate (PubChem CID 4840922) has the molecular formula C22H20N4O6 and a molecular weight of 436.42 g/mol. Its IUPAC name is [2-(3,5-dicarbamoylanilino)-2-oxoethyl] 2-(furan-2-ylmethylamino)benzoate.
| Compound Name | [2-(3,5-dicarbamoylanilino)-2-oxoethyl] 2-(furan-2-ylmethylamino)benzoate |
|---|---|
| PubChem CID | 4840922 |
| Molecular Formula | C22H20N4O6 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | [2-(3,5-dicarbamoylanilino)-2-oxoethyl] 2-(furan-2-ylmethylamino)benzoate |
| SMILES | NC(=O)c1cc(NC(=O)COC(=O)c2ccccc2NCc2ccco2)cc(C(N)=O)c1 |
| InChI | InChI=1S/C22H20N4O6/c23-20(28)13-8-14(21(24)29)10-15(9-13)26-19(27)12-32-22(30)17-5-1-2-6-18(17)25-11-16-4-3-7-31-16/h1-10,25H,11-12H2,(H2,23,28)(H2,24,29)(H,26,27) |
| InChIKey | NWHLERZZHTXQPL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 166.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |