C20H18N2O6S — CID 55465471
methyl 3-[[2-[2-(furan-2-ylmethylamino)benzoyl]oxyacetyl]amino]thiophene-2-carboxylate (PubChem CID 55465471) has the molecular formula C20H18N2O6S and a molecular weight of 414.44 g/mol. Its IUPAC name is methyl 3-[[2-[2-(furan-2-ylmethylamino)benzoyl]oxyacetyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-[2-(furan-2-ylmethylamino)benzoyl]oxyacetyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 55465471 |
| Molecular Formula | C20H18N2O6S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | methyl 3-[[2-[2-(furan-2-ylmethylamino)benzoyl]oxyacetyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)COC(=O)c1ccccc1NCc1ccco1 |
| InChI | InChI=1S/C20H18N2O6S/c1-26-20(25)18-16(8-10-29-18)22-17(23)12-28-19(24)14-6-2-3-7-15(14)21-11-13-5-4-9-27-13/h2-10,21H,11-12H2,1H3,(H,22,23) |
| InChIKey | UTEDTPPAOITPPC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |