C21H19FN2O4 — CID 7256849
[2-(5-fluoro-2-methylanilino)-2-oxoethyl] 2-(furan-2-ylmethylamino)benzoate (PubChem CID 7256849) has the molecular formula C21H19FN2O4 and a molecular weight of 382.39 g/mol. Its IUPAC name is [2-(5-fluoro-2-methylanilino)-2-oxoethyl] 2-(furan-2-ylmethylamino)benzoate.
| Compound Name | [2-(5-fluoro-2-methylanilino)-2-oxoethyl] 2-(furan-2-ylmethylamino)benzoate |
|---|---|
| PubChem CID | 7256849 |
| Molecular Formula | C21H19FN2O4 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | [2-(5-fluoro-2-methylanilino)-2-oxoethyl] 2-(furan-2-ylmethylamino)benzoate |
| SMILES | Cc1ccc(F)cc1NC(=O)COC(=O)c1ccccc1NCc1ccco1 |
| InChI | InChI=1S/C21H19FN2O4/c1-14-8-9-15(22)11-19(14)24-20(25)13-28-21(26)17-6-2-3-7-18(17)23-12-16-5-4-10-27-16/h2-11,23H,12-13H2,1H3,(H,24,25) |
| InChIKey | NFIZXGQGOZWPJN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |