C21H20FN3O3 — CID 17404436
2-[[2-(5-fluoro-2-methylanilino)-2-oxoethyl]amino]-N-(furan-2-ylmethyl)benzamide (PubChem CID 17404436) has the molecular formula C21H20FN3O3 and a molecular weight of 381.41 g/mol. Its IUPAC name is 2-[[2-(5-fluoro-2-methylanilino)-2-oxoethyl]amino]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 2-[[2-(5-fluoro-2-methylanilino)-2-oxoethyl]amino]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 17404436 |
| Molecular Formula | C21H20FN3O3 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-[[2-(5-fluoro-2-methylanilino)-2-oxoethyl]amino]-N-(furan-2-ylmethyl)benzamide |
| SMILES | Cc1ccc(F)cc1NC(=O)CNc1ccccc1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C21H20FN3O3/c1-14-8-9-15(22)11-19(14)25-20(26)13-23-18-7-3-2-6-17(18)21(27)24-12-16-5-4-10-28-16/h2-11,23H,12-13H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | DGADZCDVGRFYDG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |