C16H15F2N3O2 — CID 38253484
2-[[2-(2,5-difluoroanilino)-2-oxoethyl]amino]-N-methylbenzamide (PubChem CID 38253484) has the molecular formula C16H15F2N3O2 and a molecular weight of 319.31 g/mol. Its IUPAC name is 2-[[2-(2,5-difluoroanilino)-2-oxoethyl]amino]-N-methylbenzamide.
| Compound Name | 2-[[2-(2,5-difluoroanilino)-2-oxoethyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 38253484 |
| Molecular Formula | C16H15F2N3O2 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-[[2-(2,5-difluoroanilino)-2-oxoethyl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccccc1NCC(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C16H15F2N3O2/c1-19-16(23)11-4-2-3-5-13(11)20-9-15(22)21-14-8-10(17)6-7-12(14)18/h2-8,20H,9H2,1H3,(H,19,23)(H,21,22) |
| InChIKey | KGYMYYWAUKSHGX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |