C16H16F2N2O — CID 42069511
2-(2,5-difluoroanilino)-N-(2,3-dimethylphenyl)acetamide (PubChem CID 42069511) has the molecular formula C16H16F2N2O and a molecular weight of 290.31 g/mol. Its IUPAC name is 2-(2,5-difluoroanilino)-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-(2,5-difluoroanilino)-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 42069511 |
| Molecular Formula | C16H16F2N2O |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-(2,5-difluoroanilino)-N-(2,3-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CNc2cc(F)ccc2F)c1C |
| InChI | InChI=1S/C16H16F2N2O/c1-10-4-3-5-14(11(10)2)20-16(21)9-19-15-8-12(17)6-7-13(15)18/h3-8,19H,9H2,1-2H3,(H,20,21) |
| InChIKey | JQUFGRJCTBHXDP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |