C17H20N4O4 — CID 8772778
N-(furan-2-ylmethyl)-2-[[2-[[2-(methylamino)-2-oxoethyl]amino]acetyl]amino]benzamide (PubChem CID 8772778) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[[2-[[2-(methylamino)-2-oxoethyl]amino]acetyl]amino]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[[2-[[2-(methylamino)-2-oxoethyl]amino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 8772778 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[[2-[[2-(methylamino)-2-oxoethyl]amino]acetyl]amino]benzamide |
| SMILES | CNC(=O)CNCC(=O)Nc1ccccc1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C17H20N4O4/c1-18-15(22)10-19-11-16(23)21-14-7-3-2-6-13(14)17(24)20-9-12-5-4-8-25-12/h2-8,19H,9-11H2,1H3,(H,18,22)(H,20,24)(H,21,23) |
| InChIKey | GBFVQYMTGNJFOS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |