C19H22N2O6 — CID 17339123
2-methoxyethyl 4-[2-(furan-2-ylmethylcarbamoyl)anilino]-4-oxobutanoate (PubChem CID 17339123) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is 2-methoxyethyl 4-[2-(furan-2-ylmethylcarbamoyl)anilino]-4-oxobutanoate.
| Compound Name | 2-methoxyethyl 4-[2-(furan-2-ylmethylcarbamoyl)anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 17339123 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-methoxyethyl 4-[2-(furan-2-ylmethylcarbamoyl)anilino]-4-oxobutanoate |
| SMILES | COCCOC(=O)CCC(=O)Nc1ccccc1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C19H22N2O6/c1-25-11-12-27-18(23)9-8-17(22)21-16-7-3-2-6-15(16)19(24)20-13-14-5-4-10-26-14/h2-7,10H,8-9,11-13H2,1H3,(H,20,24)(H,21,22) |
| InChIKey | HZJOUCHOJWWUGA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|