C22H22N2O4 — CID 51283919
N-(furan-2-ylmethyl)-2-[3-(2-methoxyphenyl)propanoylamino]benzamide (PubChem CID 51283919) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[3-(2-methoxyphenyl)propanoylamino]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[3-(2-methoxyphenyl)propanoylamino]benzamide |
|---|---|
| PubChem CID | 51283919 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[3-(2-methoxyphenyl)propanoylamino]benzamide |
| SMILES | COc1ccccc1CCC(=O)Nc1ccccc1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C22H22N2O4/c1-27-20-11-5-2-7-16(20)12-13-21(25)24-19-10-4-3-9-18(19)22(26)23-15-17-8-6-14-28-17/h2-11,14H,12-13,15H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | CUFGFFPDGKSGJY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |