C21H20N2O5 — CID 94878119
N-(furan-2-ylmethyl)-2-[[2-(3-methoxyphenoxy)acetyl]amino]benzamide (PubChem CID 94878119) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[[2-(3-methoxyphenoxy)acetyl]amino]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[[2-(3-methoxyphenoxy)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 94878119 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[[2-(3-methoxyphenoxy)acetyl]amino]benzamide |
| SMILES | COc1cccc(OCC(=O)Nc2ccccc2C(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C21H20N2O5/c1-26-15-6-4-7-16(12-15)28-14-20(24)23-19-10-3-2-9-18(19)21(25)22-13-17-8-5-11-27-17/h2-12H,13-14H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | RNWZMTACEGEDQB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |