C23H18N2O6 — CID 46421125
N-(furan-2-ylmethyl)-2-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]benzamide (PubChem CID 46421125) has the molecular formula C23H18N2O6 and a molecular weight of 418.41 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]benzamide |
|---|---|
| PubChem CID | 46421125 |
| Molecular Formula | C23H18N2O6 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]benzamide |
| SMILES | O=C(COc1ccc2ccc(=O)oc2c1)Nc1ccccc1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C23H18N2O6/c26-21(14-30-16-9-7-15-8-10-22(27)31-20(15)12-16)25-19-6-2-1-5-18(19)23(28)24-13-17-4-3-11-29-17/h1-12H,13-14H2,(H,24,28)(H,25,26) |
| InChIKey | KAWPTSJDBDGRMC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|