C20H16ClFN2O4 — CID 9229573
2-[[2-(3-chloro-4-fluorophenoxy)acetyl]amino]-N-(furan-2-ylmethyl)benzamide (PubChem CID 9229573) has the molecular formula C20H16ClFN2O4 and a molecular weight of 402.81 g/mol. Its IUPAC name is 2-[[2-(3-chloro-4-fluorophenoxy)acetyl]amino]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 2-[[2-(3-chloro-4-fluorophenoxy)acetyl]amino]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 9229573 |
| Molecular Formula | C20H16ClFN2O4 |
| Molecular Weight | 402.81 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 2-[[2-(3-chloro-4-fluorophenoxy)acetyl]amino]-N-(furan-2-ylmethyl)benzamide |
| SMILES | O=C(COc1ccc(F)c(Cl)c1)Nc1ccccc1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C20H16ClFN2O4/c21-16-10-13(7-8-17(16)22)28-12-19(25)24-18-6-2-1-5-15(18)20(26)23-11-14-4-3-9-27-14/h1-10H,11-12H2,(H,23,26)(H,24,25) |
| InChIKey | IGXQBIDGJOIVAQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.81 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |