C26H22N2O8 — CID 55399528
[2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate (PubChem CID 55399528) has the molecular formula C26H22N2O8 and a molecular weight of 490.47 g/mol. Its IUPAC name is [2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate.
| Compound Name | [2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 55399528 |
| Molecular Formula | C26H22N2O8 |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | [2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate |
| SMILES | CN(C(=O)COC(=O)COc1ccc2ccc(=O)oc2c1)c1ccccc1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C26H22N2O8/c1-28(21-7-3-2-6-20(21)26(32)27-14-19-5-4-12-33-19)23(29)15-35-25(31)16-34-18-10-8-17-9-11-24(30)36-22(17)13-18/h2-13H,14-16H2,1H3,(H,27,32) |
| InChIKey | XWWQNAJYFQDVHR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 128.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|