C20H18N2O6 — CID 18154760
[2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] furan-3-carboxylate (PubChem CID 18154760) has the molecular formula C20H18N2O6 and a molecular weight of 382.37 g/mol. Its IUPAC name is [2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] furan-3-carboxylate.
| Compound Name | [2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] furan-3-carboxylate |
|---|---|
| PubChem CID | 18154760 |
| Molecular Formula | C20H18N2O6 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | [2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] furan-3-carboxylate |
| SMILES | CN(C(=O)COC(=O)c1ccoc1)c1ccccc1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C20H18N2O6/c1-22(18(23)13-28-20(25)14-8-10-26-12-14)17-7-3-2-6-16(17)19(24)21-11-15-5-4-9-27-15/h2-10,12H,11,13H2,1H3,(H,21,24) |
| InChIKey | HIWHCZNZWRKZRI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |