C26H23N3O5 — CID 55402571
[2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] 4-pyrrol-1-ylbenzoate (PubChem CID 55402571) has the molecular formula C26H23N3O5 and a molecular weight of 457.49 g/mol. Its IUPAC name is [2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] 4-pyrrol-1-ylbenzoate.
| Compound Name | [2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] 4-pyrrol-1-ylbenzoate |
|---|---|
| PubChem CID | 55402571 |
| Molecular Formula | C26H23N3O5 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | [2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] 4-pyrrol-1-ylbenzoate |
| SMILES | CN(C(=O)COC(=O)c1ccc(-n2cccc2)cc1)c1ccccc1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C26H23N3O5/c1-28(23-9-3-2-8-22(23)25(31)27-17-21-7-6-16-33-21)24(30)18-34-26(32)19-10-12-20(13-11-19)29-14-4-5-15-29/h2-16H,17-18H2,1H3,(H,27,31) |
| InChIKey | WPTJQGYAXCFCIY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |