C24H21N3O5 — CID 55401207
[2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] 1H-indole-2-carboxylate (PubChem CID 55401207) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is [2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] 1H-indole-2-carboxylate.
| Compound Name | [2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] 1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 55401207 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | [2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] 1H-indole-2-carboxylate |
| SMILES | CN(C(=O)COC(=O)c1cc2ccccc2[nH]1)c1ccccc1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C24H21N3O5/c1-27(21-11-5-3-9-18(21)23(29)25-14-17-8-6-12-31-17)22(28)15-32-24(30)20-13-16-7-2-4-10-19(16)26-20/h2-13,26H,14-15H2,1H3,(H,25,29) |
| InChIKey | LYBNZDDDXJRNBZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |