C22H20N2O6 — CID 55397483
[2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] 4-hydroxybenzoate (PubChem CID 55397483) has the molecular formula C22H20N2O6 and a molecular weight of 408.41 g/mol. Its IUPAC name is [2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] 4-hydroxybenzoate.
| Compound Name | [2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 55397483 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | [2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] 4-hydroxybenzoate |
| SMILES | CN(C(=O)COC(=O)c1ccc(O)cc1)c1ccccc1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C22H20N2O6/c1-24(20(26)14-30-22(28)15-8-10-16(25)11-9-15)19-7-3-2-6-18(19)21(27)23-13-17-5-4-12-29-17/h2-12,25H,13-14H2,1H3,(H,23,27) |
| InChIKey | PYSCJMNZLVLLJS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |