C28H23N3O4 — CID 34141104
2-[[2-[4-(4-cyanophenyl)phenoxy]acetyl]-methylamino]-N-(furan-2-ylmethyl)benzamide (PubChem CID 34141104) has the molecular formula C28H23N3O4 and a molecular weight of 465.51 g/mol. Its IUPAC name is 2-[[2-[4-(4-cyanophenyl)phenoxy]acetyl]-methylamino]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 2-[[2-[4-(4-cyanophenyl)phenoxy]acetyl]-methylamino]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 34141104 |
| Molecular Formula | C28H23N3O4 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 2-[[2-[4-(4-cyanophenyl)phenoxy]acetyl]-methylamino]-N-(furan-2-ylmethyl)benzamide |
| SMILES | CN(C(=O)COc1ccc(-c2ccc(C#N)cc2)cc1)c1ccccc1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C28H23N3O4/c1-31(26-7-3-2-6-25(26)28(33)30-18-24-5-4-16-34-24)27(32)19-35-23-14-12-22(13-15-23)21-10-8-20(17-29)9-11-21/h2-16H,18-19H2,1H3,(H,30,33) |
| InChIKey | MDMLWDOLRTYXQC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |