C25H24N2O6 — CID 55570843
[2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] 4-prop-2-enoxybenzoate (PubChem CID 55570843) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is [2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] 4-prop-2-enoxybenzoate.
| Compound Name | [2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] 4-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 55570843 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | [2-[2-(furan-2-ylmethylcarbamoyl)-N-methylanilino]-2-oxoethyl] 4-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccc(C(=O)OCC(=O)N(C)c2ccccc2C(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C25H24N2O6/c1-3-14-31-19-12-10-18(11-13-19)25(30)33-17-23(28)27(2)22-9-5-4-8-21(22)24(29)26-16-20-7-6-15-32-20/h3-13,15H,1,14,16-17H2,2H3,(H,26,29) |
| InChIKey | HULGPJXYSWNQTK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|