C30H30N4O6 — CID 4938791
N,N'-bis[2-(furan-2-ylmethylcarbamoyl)phenyl]hexanediamide (PubChem CID 4938791) has the molecular formula C30H30N4O6 and a molecular weight of 542.59 g/mol. Its IUPAC name is N,N'-bis[2-(furan-2-ylmethylcarbamoyl)phenyl]hexanediamide.
| Compound Name | N,N'-bis[2-(furan-2-ylmethylcarbamoyl)phenyl]hexanediamide |
|---|---|
| PubChem CID | 4938791 |
| Molecular Formula | C30H30N4O6 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | N,N'-bis[2-(furan-2-ylmethylcarbamoyl)phenyl]hexanediamide |
| SMILES | O=C(CCCCC(=O)Nc1ccccc1C(=O)NCc1ccco1)Nc1ccccc1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C30H30N4O6/c35-27(33-25-13-3-1-11-23(25)29(37)31-19-21-9-7-17-39-21)15-5-6-16-28(36)34-26-14-4-2-12-24(26)30(38)32-20-22-10-8-18-40-22/h1-4,7-14,17-18H,5-6,15-16,19-20H2,(H,31,37)(H,32,38)(H,33,35)(H,34,36) |
| InChIKey | JAMRWMYKQSKLDL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 142.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|