C22H21ClN2O3 — CID 55772978
2-[4-(4-chlorophenyl)butanoylamino]-N-(furan-2-ylmethyl)benzamide (PubChem CID 55772978) has the molecular formula C22H21ClN2O3 and a molecular weight of 396.87 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)butanoylamino]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 2-[4-(4-chlorophenyl)butanoylamino]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55772978 |
| Molecular Formula | C22H21ClN2O3 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 2-[4-(4-chlorophenyl)butanoylamino]-N-(furan-2-ylmethyl)benzamide |
| SMILES | O=C(CCCc1ccc(Cl)cc1)Nc1ccccc1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C22H21ClN2O3/c23-17-12-10-16(11-13-17)5-3-9-21(26)25-20-8-2-1-7-19(20)22(27)24-15-18-6-4-14-28-18/h1-2,4,6-8,10-14H,3,5,9,15H2,(H,24,27)(H,25,26) |
| InChIKey | SZNLJNCBQGAMKH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |