C21H20ClN3O5S — CID 1317344
2-[[2-(4-chloro-N-methylsulfonylanilino)acetyl]amino]-N-(furan-2-ylmethyl)benzamide (PubChem CID 1317344) has the molecular formula C21H20ClN3O5S and a molecular weight of 461.93 g/mol. Its IUPAC name is 2-[[2-(4-chloro-N-methylsulfonylanilino)acetyl]amino]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 2-[[2-(4-chloro-N-methylsulfonylanilino)acetyl]amino]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 1317344 |
| Molecular Formula | C21H20ClN3O5S |
| Molecular Weight | 461.93 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 2-[[2-(4-chloro-N-methylsulfonylanilino)acetyl]amino]-N-(furan-2-ylmethyl)benzamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1ccccc1C(=O)NCc1ccco1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H20ClN3O5S/c1-31(28,29)25(16-10-8-15(22)9-11-16)14-20(26)24-19-7-3-2-6-18(19)21(27)23-13-17-5-4-12-30-17/h2-12H,13-14H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | FAJXNBGFRAMPGA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.93 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |