C20H18FN3O3 — CID 54818535
3-[[2-(2-fluoroanilino)acetyl]amino]-N-(furan-2-ylmethyl)benzamide (PubChem CID 54818535) has the molecular formula C20H18FN3O3 and a molecular weight of 367.38 g/mol. Its IUPAC name is 3-[[2-(2-fluoroanilino)acetyl]amino]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 3-[[2-(2-fluoroanilino)acetyl]amino]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 54818535 |
| Molecular Formula | C20H18FN3O3 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 3-[[2-(2-fluoroanilino)acetyl]amino]-N-(furan-2-ylmethyl)benzamide |
| SMILES | O=C(CNc1ccccc1F)Nc1cccc(C(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C20H18FN3O3/c21-17-8-1-2-9-18(17)22-13-19(25)24-15-6-3-5-14(11-15)20(26)23-12-16-7-4-10-27-16/h1-11,22H,12-13H2,(H,23,26)(H,24,25) |
| InChIKey | HYJCAZDBJGVVGA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |