C21H21N3O4 — CID 54817531
N-(furan-2-ylmethyl)-3-[[2-(2-methoxyanilino)acetyl]amino]benzamide (PubChem CID 54817531) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-[[2-(2-methoxyanilino)acetyl]amino]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-3-[[2-(2-methoxyanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54817531 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-[[2-(2-methoxyanilino)acetyl]amino]benzamide |
| SMILES | COc1ccccc1NCC(=O)Nc1cccc(C(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C21H21N3O4/c1-27-19-10-3-2-9-18(19)22-14-20(25)24-16-7-4-6-15(12-16)21(26)23-13-17-8-5-11-28-17/h2-12,22H,13-14H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | OPQBKRACXNWQAV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |