C20H14F3NO3 — CID 2344876
[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] naphthalene-1-carboxylate (PubChem CID 2344876) has the molecular formula C20H14F3NO3 and a molecular weight of 373.33 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] naphthalene-1-carboxylate.
| Compound Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 2344876 |
| Molecular Formula | C20H14F3NO3 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] naphthalene-1-carboxylate |
| SMILES | O=C(COC(=O)c1cccc2ccccc12)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H14F3NO3/c21-20(22,23)14-8-10-15(11-9-14)24-18(25)12-27-19(26)17-7-3-5-13-4-1-2-6-16(13)17/h1-11H,12H2,(H,24,25) |
| InChIKey | BHIMUZPVEUKJSP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |