C22H17F3N2O5S — CID 42964864
[2-oxo-2-(3-sulfamoylanilino)ethyl] 2-[4-(trifluoromethyl)phenyl]benzoate (PubChem CID 42964864) has the molecular formula C22H17F3N2O5S and a molecular weight of 478.45 g/mol. Its IUPAC name is [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-[4-(trifluoromethyl)phenyl]benzoate.
| Compound Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-[4-(trifluoromethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 42964864 |
| Molecular Formula | C22H17F3N2O5S |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-[4-(trifluoromethyl)phenyl]benzoate |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)COC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C22H17F3N2O5S/c23-22(24,25)15-10-8-14(9-11-15)18-6-1-2-7-19(18)21(29)32-13-20(28)27-16-4-3-5-17(12-16)33(26,30)31/h1-12H,13H2,(H,27,28)(H2,26,30,31) |
| InChIKey | ISVOSFLKNHCFAO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |