C25H20F3NO5 — CID 2441220
[2-(2-ethoxycarbonylanilino)-2-oxoethyl] 2-[4-(trifluoromethyl)phenyl]benzoate (PubChem CID 2441220) has the molecular formula C25H20F3NO5 and a molecular weight of 471.43 g/mol. Its IUPAC name is [2-(2-ethoxycarbonylanilino)-2-oxoethyl] 2-[4-(trifluoromethyl)phenyl]benzoate.
| Compound Name | [2-(2-ethoxycarbonylanilino)-2-oxoethyl] 2-[4-(trifluoromethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 2441220 |
| Molecular Formula | C25H20F3NO5 |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | [2-(2-ethoxycarbonylanilino)-2-oxoethyl] 2-[4-(trifluoromethyl)phenyl]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)COC(=O)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H20F3NO5/c1-2-33-24(32)20-9-5-6-10-21(20)29-22(30)15-34-23(31)19-8-4-3-7-18(19)16-11-13-17(14-12-16)25(26,27)28/h3-14H,2,15H2,1H3,(H,29,30) |
| InChIKey | HUIAGLZYCOPJCD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |