C22H15F3N2O5 — CID 5080642
[2-(4-nitroanilino)-2-oxoethyl] 2-[4-(trifluoromethyl)phenyl]benzoate (PubChem CID 5080642) has the molecular formula C22H15F3N2O5 and a molecular weight of 444.37 g/mol. Its IUPAC name is [2-(4-nitroanilino)-2-oxoethyl] 2-[4-(trifluoromethyl)phenyl]benzoate.
| Compound Name | [2-(4-nitroanilino)-2-oxoethyl] 2-[4-(trifluoromethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 5080642 |
| Molecular Formula | C22H15F3N2O5 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | [2-(4-nitroanilino)-2-oxoethyl] 2-[4-(trifluoromethyl)phenyl]benzoate |
| SMILES | O=C(COC(=O)c1ccccc1-c1ccc(C(F)(F)F)cc1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H15F3N2O5/c23-22(24,25)15-7-5-14(6-8-15)18-3-1-2-4-19(18)21(29)32-13-20(28)26-16-9-11-17(12-10-16)27(30)31/h1-12H,13H2,(H,26,28) |
| InChIKey | YRBIHCHJGJTSNT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|