C17H13F3N2O5 — CID 2091999
[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 2-(2-nitrophenyl)acetate (PubChem CID 2091999) has the molecular formula C17H13F3N2O5 and a molecular weight of 382.29 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 2-(2-nitrophenyl)acetate.
| Compound Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 2-(2-nitrophenyl)acetate |
|---|---|
| PubChem CID | 2091999 |
| Molecular Formula | C17H13F3N2O5 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 2-(2-nitrophenyl)acetate |
| SMILES | O=C(COC(=O)Cc1ccccc1[N+](=O)[O-])Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13F3N2O5/c18-17(19,20)12-5-7-13(8-6-12)21-15(23)10-27-16(24)9-11-3-1-2-4-14(11)22(25)26/h1-8H,9-10H2,(H,21,23) |
| InChIKey | FZCDYMSMIOQSAQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|