C16H10ClF3N2O5 — CID 7768132
[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 4-chloro-3-nitrobenzoate (PubChem CID 7768132) has the molecular formula C16H10ClF3N2O5 and a molecular weight of 402.71 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 4-chloro-3-nitrobenzoate.
| Compound Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 7768132 |
| Molecular Formula | C16H10ClF3N2O5 |
| Molecular Weight | 402.71 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 4-chloro-3-nitrobenzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H10ClF3N2O5/c17-12-6-1-9(7-13(12)22(25)26)15(24)27-8-14(23)21-11-4-2-10(3-5-11)16(18,19)20/h1-7H,8H2,(H,21,23) |
| InChIKey | MZWDPYVUDZQCQX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.71 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|