C18H15ClN2O5 — CID 7764899
[2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 4-chloro-3-nitrobenzoate (PubChem CID 7764899) has the molecular formula C18H15ClN2O5 and a molecular weight of 374.78 g/mol. Its IUPAC name is [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 4-chloro-3-nitrobenzoate.
| Compound Name | [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 7764899 |
| Molecular Formula | C18H15ClN2O5 |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 4-chloro-3-nitrobenzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C18H15ClN2O5/c19-15-7-5-13(9-16(15)21(24)25)18(23)26-10-17(22)20-14-6-4-11-2-1-3-12(11)8-14/h4-9H,1-3,10H2,(H,20,22) |
| InChIKey | LFYSRWCSAVCERZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|