C19H19NO3 — CID 2640652
[2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 4-methylbenzoate (PubChem CID 2640652) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 4-methylbenzoate.
| Compound Name | [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 2640652 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)Nc2ccc3c(c2)CCC3)cc1 |
| InChI | InChI=1S/C19H19NO3/c1-13-5-7-15(8-6-13)19(22)23-12-18(21)20-17-10-9-14-3-2-4-16(14)11-17/h5-11H,2-4,12H2,1H3,(H,20,21) |
| InChIKey | GANSECDFJCLNAL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |