C26H22ClNO5 — CID 2490260
[2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 4-(4-acetyloxy-3-chlorophenyl)benzoate (PubChem CID 2490260) has the molecular formula C26H22ClNO5 and a molecular weight of 463.92 g/mol. Its IUPAC name is [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 4-(4-acetyloxy-3-chlorophenyl)benzoate.
| Compound Name | [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 4-(4-acetyloxy-3-chlorophenyl)benzoate |
|---|---|
| PubChem CID | 2490260 |
| Molecular Formula | C26H22ClNO5 |
| Molecular Weight | 463.92 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 4-(4-acetyloxy-3-chlorophenyl)benzoate |
| SMILES | CC(=O)Oc1ccc(-c2ccc(C(=O)OCC(=O)Nc3ccc4c(c3)CCC4)cc2)cc1Cl |
| InChI | InChI=1S/C26H22ClNO5/c1-16(29)33-24-12-10-21(14-23(24)27)18-5-7-19(8-6-18)26(31)32-15-25(30)28-22-11-9-17-3-2-4-20(17)13-22/h5-14H,2-4,15H2,1H3,(H,28,30) |
| InChIKey | REZXEVGIHQAZKE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.92 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|