C18H17ClN2O6 — CID 7193525
[2-(4-chloro-3-nitroanilino)-2-oxoethyl] 4-propan-2-yloxybenzoate (PubChem CID 7193525) has the molecular formula C18H17ClN2O6 and a molecular weight of 392.80 g/mol. Its IUPAC name is [2-(4-chloro-3-nitroanilino)-2-oxoethyl] 4-propan-2-yloxybenzoate.
| Compound Name | [2-(4-chloro-3-nitroanilino)-2-oxoethyl] 4-propan-2-yloxybenzoate |
|---|---|
| PubChem CID | 7193525 |
| Molecular Formula | C18H17ClN2O6 |
| Molecular Weight | 392.80 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | [2-(4-chloro-3-nitroanilino)-2-oxoethyl] 4-propan-2-yloxybenzoate |
| SMILES | CC(C)Oc1ccc(C(=O)OCC(=O)Nc2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C18H17ClN2O6/c1-11(2)27-14-6-3-12(4-7-14)18(23)26-10-17(22)20-13-5-8-15(19)16(9-13)21(24)25/h3-9,11H,10H2,1-2H3,(H,20,22) |
| InChIKey | LVRLTEKHFKAGIT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.80 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|