C15H9ClF3N3O4 — CID 108512875
N'-(4-chloro-3-nitrophenyl)-N-[4-(trifluoromethyl)phenyl]oxamide (PubChem CID 108512875) has the molecular formula C15H9ClF3N3O4 and a molecular weight of 387.70 g/mol. Its IUPAC name is N'-(4-chloro-3-nitrophenyl)-N-[4-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N'-(4-chloro-3-nitrophenyl)-N-[4-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 108512875 |
| Molecular Formula | C15H9ClF3N3O4 |
| Molecular Weight | 387.70 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | N'-(4-chloro-3-nitrophenyl)-N-[4-(trifluoromethyl)phenyl]oxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)C(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H9ClF3N3O4/c16-11-6-5-10(7-12(11)22(25)26)21-14(24)13(23)20-9-3-1-8(2-4-9)15(17,18)19/h1-7H,(H,20,23)(H,21,24) |
| InChIKey | YSYPIOXMXQRMQF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.70 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|