C18H13ClF3N3O6 — CID 35661556
[2-(4-chloro-3-nitroanilino)-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate (PubChem CID 35661556) has the molecular formula C18H13ClF3N3O6 and a molecular weight of 459.76 g/mol. Its IUPAC name is [2-(4-chloro-3-nitroanilino)-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate.
| Compound Name | [2-(4-chloro-3-nitroanilino)-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 35661556 |
| Molecular Formula | C18H13ClF3N3O6 |
| Molecular Weight | 459.76 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | [2-(4-chloro-3-nitroanilino)-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccc(C(F)(F)F)cc1)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H13ClF3N3O6/c19-13-6-5-12(7-14(13)25(29)30)24-15(26)9-31-16(27)8-23-17(28)10-1-3-11(4-2-10)18(20,21)22/h1-7H,8-9H2,(H,23,28)(H,24,26) |
| InChIKey | BCANZUAFBKRXMG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.76 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|