C23H18ClN3O7 — CID 29310803
[2-oxo-2-(4-phenoxyanilino)ethyl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate (PubChem CID 29310803) has the molecular formula C23H18ClN3O7 and a molecular weight of 483.86 g/mol. Its IUPAC name is [2-oxo-2-(4-phenoxyanilino)ethyl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate.
| Compound Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 29310803 |
| Molecular Formula | C23H18ClN3O7 |
| Molecular Weight | 483.86 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H18ClN3O7/c24-19-11-6-15(12-20(19)27(31)32)23(30)25-13-22(29)33-14-21(28)26-16-7-9-18(10-8-16)34-17-4-2-1-3-5-17/h1-12H,13-14H2,(H,25,30)(H,26,28) |
| InChIKey | SLNUVFJXTDYHRO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.86 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|