C20H20ClN3O9 — CID 29335268
[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate (PubChem CID 29335268) has the molecular formula C20H20ClN3O9 and a molecular weight of 481.85 g/mol. Its IUPAC name is [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate.
| Compound Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 29335268 |
| Molecular Formula | C20H20ClN3O9 |
| Molecular Weight | 481.85 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate |
| SMILES | COc1cc(NC(=O)COC(=O)CNC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)cc(OC)c1OC |
| InChI | InChI=1S/C20H20ClN3O9/c1-30-15-7-12(8-16(31-2)19(15)32-3)23-17(25)10-33-18(26)9-22-20(27)11-4-5-13(21)14(6-11)24(28)29/h4-8H,9-10H2,1-3H3,(H,22,27)(H,23,25) |
| InChIKey | QLWUZRKEOOBGMI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 155.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.85 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|