C17H14ClN3O6 — CID 7877303
(2-anilino-2-oxoethyl) 2-[(4-chloro-3-nitrobenzoyl)amino]acetate (PubChem CID 7877303) has the molecular formula C17H14ClN3O6 and a molecular weight of 391.77 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 2-[(4-chloro-3-nitrobenzoyl)amino]acetate.
| Compound Name | (2-anilino-2-oxoethyl) 2-[(4-chloro-3-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7877303 |
| Molecular Formula | C17H14ClN3O6 |
| Molecular Weight | 391.77 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | (2-anilino-2-oxoethyl) 2-[(4-chloro-3-nitrobenzoyl)amino]acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)Nc1ccccc1 |
| InChI | InChI=1S/C17H14ClN3O6/c18-13-7-6-11(8-14(13)21(25)26)17(24)19-9-16(23)27-10-15(22)20-12-4-2-1-3-5-12/h1-8H,9-10H2,(H,19,24)(H,20,22) |
| InChIKey | LGVNJEYDRULFLJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.77 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|