C20H19ClN4O7 — CID 27013135
[2-[(2,3-dimethylphenyl)carbamoylamino]-2-oxoethyl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate (PubChem CID 27013135) has the molecular formula C20H19ClN4O7 and a molecular weight of 462.85 g/mol. Its IUPAC name is [2-[(2,3-dimethylphenyl)carbamoylamino]-2-oxoethyl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate.
| Compound Name | [2-[(2,3-dimethylphenyl)carbamoylamino]-2-oxoethyl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 27013135 |
| Molecular Formula | C20H19ClN4O7 |
| Molecular Weight | 462.85 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | [2-[(2,3-dimethylphenyl)carbamoylamino]-2-oxoethyl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate |
| SMILES | Cc1cccc(NC(=O)NC(=O)COC(=O)CNC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)c1C |
| InChI | InChI=1S/C20H19ClN4O7/c1-11-4-3-5-15(12(11)2)23-20(29)24-17(26)10-32-18(27)9-22-19(28)13-6-7-14(21)16(8-13)25(30)31/h3-8H,9-10H2,1-2H3,(H,22,28)(H2,23,24,26,29) |
| InChIKey | MKWPQHOCXPIUDJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.85 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|