C24H21ClN2O6 — CID 2367160
[2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-[(4-phenoxybenzoyl)amino]acetate (PubChem CID 2367160) has the molecular formula C24H21ClN2O6 and a molecular weight of 468.89 g/mol. Its IUPAC name is [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-[(4-phenoxybenzoyl)amino]acetate.
| Compound Name | [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-[(4-phenoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 2367160 |
| Molecular Formula | C24H21ClN2O6 |
| Molecular Weight | 468.89 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-[(4-phenoxybenzoyl)amino]acetate |
| SMILES | COc1ccc(NC(=O)COC(=O)CNC(=O)c2ccc(Oc3ccccc3)cc2)cc1Cl |
| InChI | InChI=1S/C24H21ClN2O6/c1-31-21-12-9-17(13-20(21)25)27-22(28)15-32-23(29)14-26-24(30)16-7-10-19(11-8-16)33-18-5-3-2-4-6-18/h2-13H,14-15H2,1H3,(H,26,30)(H,27,28) |
| InChIKey | JNKWHNNKJZTWIJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.89 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |