C18H16BrClN2O5 — CID 46789730
[2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-[(4-bromobenzoyl)amino]acetate (PubChem CID 46789730) has the molecular formula C18H16BrClN2O5 and a molecular weight of 455.69 g/mol. Its IUPAC name is [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-[(4-bromobenzoyl)amino]acetate.
| Compound Name | [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-[(4-bromobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 46789730 |
| Molecular Formula | C18H16BrClN2O5 |
| Molecular Weight | 455.69 g/mol |
| Exact Mass | 453.99 |
| IUPAC Name | [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-[(4-bromobenzoyl)amino]acetate |
| SMILES | COc1ccc(NC(=O)COC(=O)CNC(=O)c2ccc(Br)cc2)cc1Cl |
| InChI | InChI=1S/C18H16BrClN2O5/c1-26-15-7-6-13(8-14(15)20)22-16(23)10-27-17(24)9-21-18(25)11-2-4-12(19)5-3-11/h2-8H,9-10H2,1H3,(H,21,25)(H,22,23) |
| InChIKey | GZXGEYXYRIMDNW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.69 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |