C18H19ClN2O4 — CID 8014586
N-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-4-ethoxybenzamide (PubChem CID 8014586) has the molecular formula C18H19ClN2O4 and a molecular weight of 362.81 g/mol. Its IUPAC name is N-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-4-ethoxybenzamide.
| Compound Name | N-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 8014586 |
| Molecular Formula | C18H19ClN2O4 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | N-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCC(=O)Nc2ccc(OC)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H19ClN2O4/c1-3-25-14-7-4-12(5-8-14)18(23)20-11-17(22)21-13-6-9-16(24-2)15(19)10-13/h4-10H,3,11H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | UISPFADSSDAFOW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |