C20H22N2O7 — CID 2355966
[2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-[(4-methoxybenzoyl)amino]acetate (PubChem CID 2355966) has the molecular formula C20H22N2O7 and a molecular weight of 402.40 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-[(4-methoxybenzoyl)amino]acetate.
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-[(4-methoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 2355966 |
| Molecular Formula | C20H22N2O7 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-[(4-methoxybenzoyl)amino]acetate |
| SMILES | COc1ccc(C(=O)NCC(=O)OCC(=O)Nc2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C20H22N2O7/c1-26-14-6-4-13(5-7-14)20(25)21-11-19(24)29-12-18(23)22-16-10-15(27-2)8-9-17(16)28-3/h4-10H,11-12H2,1-3H3,(H,21,25)(H,22,23) |
| InChIKey | UVSGGIQGLDFYRR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |