C25H33NO5 — CID 2632423
[2-(2,5-dimethoxyanilino)-2-oxoethyl] 3,5-ditert-butylbenzoate (PubChem CID 2632423) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl] 3,5-ditert-butylbenzoate.
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 3,5-ditert-butylbenzoate |
|---|---|
| PubChem CID | 2632423 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 3,5-ditert-butylbenzoate |
| SMILES | COc1ccc(OC)c(NC(=O)COC(=O)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C25H33NO5/c1-24(2,3)17-11-16(12-18(13-17)25(4,5)6)23(28)31-15-22(27)26-20-14-19(29-7)9-10-21(20)30-8/h9-14H,15H2,1-8H3,(H,26,27) |
| InChIKey | DPYDQCKDKZNCDU-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |